C20H21FN4OS — CID 37179703
N-[4-fluoro-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-2,5-dimethylthiophene-3-carboxamide (PubChem CID 37179703) has the molecular formula C20H21FN4OS and a molecular weight of 384.48 g/mol. Its IUPAC name is N-[4-fluoro-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-2,5-dimethylthiophene-3-carboxamide.
| Compound Name | N-[4-fluoro-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-2,5-dimethylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 37179703 |
| Molecular Formula | C20H21FN4OS |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | N-[4-fluoro-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-2,5-dimethylthiophene-3-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2ccc(F)c(-c3nnc4n3CCCCC4)c2)c(C)s1 |
| InChI | InChI=1S/C20H21FN4OS/c1-12-10-15(13(2)27-12)20(26)22-14-7-8-17(21)16(11-14)19-24-23-18-6-4-3-5-9-25(18)19/h7-8,10-11H,3-6,9H2,1-2H3,(H,22,26) |
| InChIKey | HLHMNIUTVTUDQO-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |