C23H26FN5O3S — CID 37179991
N-[4-fluoro-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-3,4-dimethyl-5-(methylsulfamoyl)benzamide (PubChem CID 37179991) has the molecular formula C23H26FN5O3S and a molecular weight of 471.56 g/mol. Its IUPAC name is N-[4-fluoro-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-3,4-dimethyl-5-(methylsulfamoyl)benzamide.
| Compound Name | N-[4-fluoro-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-3,4-dimethyl-5-(methylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 37179991 |
| Molecular Formula | C23H26FN5O3S |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | N-[4-fluoro-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-3,4-dimethyl-5-(methylsulfamoyl)benzamide |
| SMILES | CNS(=O)(=O)c1cc(C(=O)Nc2ccc(F)c(-c3nnc4n3CCCCC4)c2)cc(C)c1C |
| InChI | InChI=1S/C23H26FN5O3S/c1-14-11-16(12-20(15(14)2)33(31,32)25-3)23(30)26-17-8-9-19(24)18(13-17)22-28-27-21-7-5-4-6-10-29(21)22/h8-9,11-13,25H,4-7,10H2,1-3H3,(H,26,30) |
| InChIKey | UKGSXQFHHHSSLY-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |