C24H28FN5O3S — CID 30603450
3-(diethylsulfamoyl)-N-[4-fluoro-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]benzamide (PubChem CID 30603450) has the molecular formula C24H28FN5O3S and a molecular weight of 485.59 g/mol. Its IUPAC name is 3-(diethylsulfamoyl)-N-[4-fluoro-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]benzamide.
| Compound Name | 3-(diethylsulfamoyl)-N-[4-fluoro-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 30603450 |
| Molecular Formula | C24H28FN5O3S |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.19 |
| IUPAC Name | 3-(diethylsulfamoyl)-N-[4-fluoro-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(C(=O)Nc2ccc(F)c(-c3nnc4n3CCCCC4)c2)c1 |
| InChI | InChI=1S/C24H28FN5O3S/c1-3-29(4-2)34(32,33)19-10-8-9-17(15-19)24(31)26-18-12-13-21(25)20(16-18)23-28-27-22-11-6-5-7-14-30(22)23/h8-10,12-13,15-16H,3-7,11,14H2,1-2H3,(H,26,31) |
| InChIKey | FVMWCWXMRDSXCS-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |