C21H21ClN4OS — CID 112813271
N-[4-chloro-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-2-methylsulfanylbenzamide (PubChem CID 112813271) has the molecular formula C21H21ClN4OS and a molecular weight of 412.95 g/mol. Its IUPAC name is N-[4-chloro-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-2-methylsulfanylbenzamide.
| Compound Name | N-[4-chloro-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-2-methylsulfanylbenzamide |
|---|---|
| PubChem CID | 112813271 |
| Molecular Formula | C21H21ClN4OS |
| Molecular Weight | 412.95 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | N-[4-chloro-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-2-methylsulfanylbenzamide |
| SMILES | CSc1ccccc1C(=O)Nc1ccc(Cl)c(-c2nnc3n2CCCCC3)c1 |
| InChI | InChI=1S/C21H21ClN4OS/c1-28-18-8-5-4-7-15(18)21(27)23-14-10-11-17(22)16(13-14)20-25-24-19-9-3-2-6-12-26(19)20/h4-5,7-8,10-11,13H,2-3,6,9,12H2,1H3,(H,23,27) |
| InChIKey | OCLIKYYGRHJDSY-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.95 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |