C10H8N2O3S2 — CID 43354490
2-[(2-thiophen-3-yl-1,3-thiazole-4-carbonyl)amino]acetic acid (PubChem CID 43354490) has the molecular formula C10H8N2O3S2 and a molecular weight of 268.32 g/mol. Its IUPAC name is 2-[(2-thiophen-3-yl-1,3-thiazole-4-carbonyl)amino]acetic acid.
| Compound Name | 2-[(2-thiophen-3-yl-1,3-thiazole-4-carbonyl)amino]acetic acid |
|---|---|
| PubChem CID | 43354490 |
| Molecular Formula | C10H8N2O3S2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.00 |
| IUPAC Name | 2-[(2-thiophen-3-yl-1,3-thiazole-4-carbonyl)amino]acetic acid |
| SMILES | O=C(O)CNC(=O)c1csc(-c2ccsc2)n1 |
| InChI | InChI=1S/C10H8N2O3S2/c13-8(14)3-11-9(15)7-5-17-10(12-7)6-1-2-16-4-6/h1-2,4-5H,3H2,(H,11,15)(H,13,14) |
| InChIKey | QRXAIXYJXUJNSZ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |