C16H10F3N3O2S2 — CID 46565546
N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-2-thiophen-3-yl-1,3-thiazole-4-carboxamide (PubChem CID 46565546) has the molecular formula C16H10F3N3O2S2 and a molecular weight of 397.40 g/mol. Its IUPAC name is N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-2-thiophen-3-yl-1,3-thiazole-4-carboxamide.
| Compound Name | N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-2-thiophen-3-yl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 46565546 |
| Molecular Formula | C16H10F3N3O2S2 |
| Molecular Weight | 397.40 g/mol |
| Exact Mass | 397.02 |
| IUPAC Name | N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-2-thiophen-3-yl-1,3-thiazole-4-carboxamide |
| SMILES | O=C(CNC(=O)c1csc(-c2ccsc2)n1)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C16H10F3N3O2S2/c17-9-1-2-10(14(19)13(9)18)21-12(23)5-20-15(24)11-7-26-16(22-11)8-3-4-25-6-8/h1-4,6-7H,5H2,(H,20,24)(H,21,23) |
| InChIKey | PIKRFWNJVVAFFR-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.40 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|