C16H14F3N3O3S — CID 27813046
N-[3-oxo-3-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propyl]thiophene-3-carboxamide (PubChem CID 27813046) has the molecular formula C16H14F3N3O3S and a molecular weight of 385.37 g/mol. Its IUPAC name is N-[3-oxo-3-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propyl]thiophene-3-carboxamide.
| Compound Name | N-[3-oxo-3-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 27813046 |
| Molecular Formula | C16H14F3N3O3S |
| Molecular Weight | 385.37 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | N-[3-oxo-3-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propyl]thiophene-3-carboxamide |
| SMILES | O=C(CCNC(=O)c1ccsc1)NCC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C16H14F3N3O3S/c17-10-1-2-11(15(19)14(10)18)22-13(24)7-21-12(23)3-5-20-16(25)9-4-6-26-8-9/h1-2,4,6,8H,3,5,7H2,(H,20,25)(H,21,23)(H,22,24) |
| InChIKey | RUCXJYOOBBHIPG-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.37 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|