C15H12F3N3O4 — CID 55648350
N-[2-oxo-2-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]ethyl]furan-3-carboxamide (PubChem CID 55648350) has the molecular formula C15H12F3N3O4 and a molecular weight of 355.27 g/mol. Its IUPAC name is N-[2-oxo-2-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]ethyl]furan-3-carboxamide.
| Compound Name | N-[2-oxo-2-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]ethyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 55648350 |
| Molecular Formula | C15H12F3N3O4 |
| Molecular Weight | 355.27 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | N-[2-oxo-2-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]ethyl]furan-3-carboxamide |
| SMILES | O=C(CNC(=O)c1ccoc1)NCC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C15H12F3N3O4/c16-9-1-2-10(14(18)13(9)17)21-12(23)6-19-11(22)5-20-15(24)8-3-4-25-7-8/h1-4,7H,5-6H2,(H,19,22)(H,20,24)(H,21,23) |
| InChIKey | CGOLPWRNMVZFNH-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.27 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|