C22H16ClF3N2O2S — CID 27812929
4-[(4-chlorophenyl)sulfanylmethyl]-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]benzamide (PubChem CID 27812929) has the molecular formula C22H16ClF3N2O2S and a molecular weight of 464.90 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)sulfanylmethyl]-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]benzamide.
| Compound Name | 4-[(4-chlorophenyl)sulfanylmethyl]-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]benzamide |
|---|---|
| PubChem CID | 27812929 |
| Molecular Formula | C22H16ClF3N2O2S |
| Molecular Weight | 464.90 g/mol |
| Exact Mass | 464.06 |
| IUPAC Name | 4-[(4-chlorophenyl)sulfanylmethyl]-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccc(CSc2ccc(Cl)cc2)cc1)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C22H16ClF3N2O2S/c23-15-5-7-16(8-6-15)31-12-13-1-3-14(4-2-13)22(30)27-11-19(29)28-18-10-9-17(24)20(25)21(18)26/h1-10H,11-12H2,(H,27,30)(H,28,29) |
| InChIKey | QJWMCRXBJNAWQZ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.90 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|