C23H19Cl2NO3S — CID 30396105
ethyl 3-chloro-4-[[4-[(4-chlorophenyl)sulfanylmethyl]benzoyl]amino]benzoate (PubChem CID 30396105) has the molecular formula C23H19Cl2NO3S and a molecular weight of 460.38 g/mol. Its IUPAC name is ethyl 3-chloro-4-[[4-[(4-chlorophenyl)sulfanylmethyl]benzoyl]amino]benzoate.
| Compound Name | ethyl 3-chloro-4-[[4-[(4-chlorophenyl)sulfanylmethyl]benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 30396105 |
| Molecular Formula | C23H19Cl2NO3S |
| Molecular Weight | 460.38 g/mol |
| Exact Mass | 459.05 |
| IUPAC Name | ethyl 3-chloro-4-[[4-[(4-chlorophenyl)sulfanylmethyl]benzoyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)c2ccc(CSc3ccc(Cl)cc3)cc2)c(Cl)c1 |
| InChI | InChI=1S/C23H19Cl2NO3S/c1-2-29-23(28)17-7-12-21(20(25)13-17)26-22(27)16-5-3-15(4-6-16)14-30-19-10-8-18(24)9-11-19/h3-13H,2,14H2,1H3,(H,26,27) |
| InChIKey | JSNZLYXKORLVQQ-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.38 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |