C17H13ClF3NO3 — CID 56632233
ethyl 3-chloro-4-[[3-(trifluoromethyl)benzoyl]amino]benzoate (PubChem CID 56632233) has the molecular formula C17H13ClF3NO3 and a molecular weight of 371.74 g/mol. Its IUPAC name is ethyl 3-chloro-4-[[3-(trifluoromethyl)benzoyl]amino]benzoate.
| Compound Name | ethyl 3-chloro-4-[[3-(trifluoromethyl)benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 56632233 |
| Molecular Formula | C17H13ClF3NO3 |
| Molecular Weight | 371.74 g/mol |
| Exact Mass | 371.05 |
| IUPAC Name | ethyl 3-chloro-4-[[3-(trifluoromethyl)benzoyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)c2cccc(C(F)(F)F)c2)c(Cl)c1 |
| InChI | InChI=1S/C17H13ClF3NO3/c1-2-25-16(24)11-6-7-14(13(18)9-11)22-15(23)10-4-3-5-12(8-10)17(19,20)21/h3-9H,2H2,1H3,(H,22,23) |
| InChIKey | PHJCDYIMYSHDLF-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.74 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |