C24H21F3N2O4 — CID 54422821
ethyl 3-[[4-methoxy-3-[3-(trifluoromethyl)anilino]benzoyl]amino]benzoate (PubChem CID 54422821) has the molecular formula C24H21F3N2O4 and a molecular weight of 458.44 g/mol. Its IUPAC name is ethyl 3-[[4-methoxy-3-[3-(trifluoromethyl)anilino]benzoyl]amino]benzoate.
| Compound Name | ethyl 3-[[4-methoxy-3-[3-(trifluoromethyl)anilino]benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 54422821 |
| Molecular Formula | C24H21F3N2O4 |
| Molecular Weight | 458.44 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | ethyl 3-[[4-methoxy-3-[3-(trifluoromethyl)anilino]benzoyl]amino]benzoate |
| SMILES | CCOC(=O)c1cccc(NC(=O)c2ccc(OC)c(Nc3cccc(C(F)(F)F)c3)c2)c1 |
| InChI | InChI=1S/C24H21F3N2O4/c1-3-33-23(31)16-6-4-8-18(12-16)29-22(30)15-10-11-21(32-2)20(13-15)28-19-9-5-7-17(14-19)24(25,26)27/h4-14,28H,3H2,1-2H3,(H,29,30) |
| InChIKey | WBZPDUVLZZHPEW-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.44 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |