C17H14F3NO4 — CID 17362444
[2-methoxy-4-[[3-(trifluoromethyl)phenyl]carbamoyl]phenyl] acetate (PubChem CID 17362444) has the molecular formula C17H14F3NO4 and a molecular weight of 353.30 g/mol. Its IUPAC name is [2-methoxy-4-[[3-(trifluoromethyl)phenyl]carbamoyl]phenyl] acetate.
| Compound Name | [2-methoxy-4-[[3-(trifluoromethyl)phenyl]carbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 17362444 |
| Molecular Formula | C17H14F3NO4 |
| Molecular Weight | 353.30 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | [2-methoxy-4-[[3-(trifluoromethyl)phenyl]carbamoyl]phenyl] acetate |
| SMILES | COc1cc(C(=O)Nc2cccc(C(F)(F)F)c2)ccc1OC(C)=O |
| InChI | InChI=1S/C17H14F3NO4/c1-10(22)25-14-7-6-11(8-15(14)24-2)16(23)21-13-5-3-4-12(9-13)17(18,19)20/h3-9H,1-2H3,(H,21,23) |
| InChIKey | JHKLDQVFQXASCO-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.30 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|