C27H27N3O9 — CID 126229853
[2-methoxy-4-[[3-[[(3,4,5-trimethoxybenzoyl)amino]carbamoyl]phenyl]carbamoyl]phenyl] acetate (PubChem CID 126229853) has the molecular formula C27H27N3O9 and a molecular weight of 537.53 g/mol. Its IUPAC name is [2-methoxy-4-[[3-[[(3,4,5-trimethoxybenzoyl)amino]carbamoyl]phenyl]carbamoyl]phenyl] acetate.
| Compound Name | [2-methoxy-4-[[3-[[(3,4,5-trimethoxybenzoyl)amino]carbamoyl]phenyl]carbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 126229853 |
| Molecular Formula | C27H27N3O9 |
| Molecular Weight | 537.53 g/mol |
| Exact Mass | 537.17 |
| IUPAC Name | [2-methoxy-4-[[3-[[(3,4,5-trimethoxybenzoyl)amino]carbamoyl]phenyl]carbamoyl]phenyl] acetate |
| SMILES | COc1cc(C(=O)Nc2cccc(C(=O)NNC(=O)c3cc(OC)c(OC)c(OC)c3)c2)ccc1OC(C)=O |
| InChI | InChI=1S/C27H27N3O9/c1-15(31)39-20-10-9-17(12-21(20)35-2)25(32)28-19-8-6-7-16(11-19)26(33)29-30-27(34)18-13-22(36-3)24(38-5)23(14-18)37-4/h6-14H,1-5H3,(H,28,32)(H,29,33)(H,30,34) |
| InChIKey | JCNAKQIQIRWXOW-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 150.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.53 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|