C24H20ClN3O6 — CID 126230266
[4-[[[3-[(4-chlorobenzoyl)amino]benzoyl]amino]carbamoyl]-2-methoxyphenyl] acetate (PubChem CID 126230266) has the molecular formula C24H20ClN3O6 and a molecular weight of 481.89 g/mol. Its IUPAC name is [4-[[[3-[(4-chlorobenzoyl)amino]benzoyl]amino]carbamoyl]-2-methoxyphenyl] acetate.
| Compound Name | [4-[[[3-[(4-chlorobenzoyl)amino]benzoyl]amino]carbamoyl]-2-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 126230266 |
| Molecular Formula | C24H20ClN3O6 |
| Molecular Weight | 481.89 g/mol |
| Exact Mass | 481.10 |
| IUPAC Name | [4-[[[3-[(4-chlorobenzoyl)amino]benzoyl]amino]carbamoyl]-2-methoxyphenyl] acetate |
| SMILES | COc1cc(C(=O)NNC(=O)c2cccc(NC(=O)c3ccc(Cl)cc3)c2)ccc1OC(C)=O |
| InChI | InChI=1S/C24H20ClN3O6/c1-14(29)34-20-11-8-17(13-21(20)33-2)24(32)28-27-23(31)16-4-3-5-19(12-16)26-22(30)15-6-9-18(25)10-7-15/h3-13H,1-2H3,(H,26,30)(H,27,31)(H,28,32) |
| InChIKey | KDPGBAAARGSBJG-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.89 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|