C16H13Cl2NO5 — CID 2993167
[4-[(3,5-dichloro-4-hydroxyphenyl)carbamoyl]-2-methoxyphenyl] acetate (PubChem CID 2993167) has the molecular formula C16H13Cl2NO5 and a molecular weight of 370.19 g/mol. Its IUPAC name is [4-[(3,5-dichloro-4-hydroxyphenyl)carbamoyl]-2-methoxyphenyl] acetate.
| Compound Name | [4-[(3,5-dichloro-4-hydroxyphenyl)carbamoyl]-2-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 2993167 |
| Molecular Formula | C16H13Cl2NO5 |
| Molecular Weight | 370.19 g/mol |
| Exact Mass | 369.02 |
| IUPAC Name | [4-[(3,5-dichloro-4-hydroxyphenyl)carbamoyl]-2-methoxyphenyl] acetate |
| SMILES | COc1cc(C(=O)Nc2cc(Cl)c(O)c(Cl)c2)ccc1OC(C)=O |
| InChI | InChI=1S/C16H13Cl2NO5/c1-8(20)24-13-4-3-9(5-14(13)23-2)16(22)19-10-6-11(17)15(21)12(18)7-10/h3-7,21H,1-2H3,(H,19,22) |
| InChIKey | SFBFKJBIFWQOIA-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.19 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|