C18H16ClNO6 — CID 143409821
2-[(4-acetyloxy-3-methoxybenzoyl)amino]-4-chloro-6-methylbenzoic acid (PubChem CID 143409821) has the molecular formula C18H16ClNO6 and a molecular weight of 377.78 g/mol. Its IUPAC name is 2-[(4-acetyloxy-3-methoxybenzoyl)amino]-4-chloro-6-methylbenzoic acid.
| Compound Name | 2-[(4-acetyloxy-3-methoxybenzoyl)amino]-4-chloro-6-methylbenzoic acid |
|---|---|
| PubChem CID | 143409821 |
| Molecular Formula | C18H16ClNO6 |
| Molecular Weight | 377.78 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | 2-[(4-acetyloxy-3-methoxybenzoyl)amino]-4-chloro-6-methylbenzoic acid |
| SMILES | COc1cc(C(=O)Nc2cc(Cl)cc(C)c2C(=O)O)ccc1OC(C)=O |
| InChI | InChI=1S/C18H16ClNO6/c1-9-6-12(19)8-13(16(9)18(23)24)20-17(22)11-4-5-14(26-10(2)21)15(7-11)25-3/h4-8H,1-3H3,(H,20,22)(H,23,24) |
| InChIKey | MCEBBWAPDHVWSF-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.78 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|