C25H28N4O6 — CID 50792247
[4-[(1,4-dimethyl-2,3-dioxo-7-piperidin-1-ylquinoxalin-6-yl)carbamoyl]-2-methoxyphenyl] acetate (PubChem CID 50792247) has the molecular formula C25H28N4O6 and a molecular weight of 480.52 g/mol. Its IUPAC name is [4-[(1,4-dimethyl-2,3-dioxo-7-piperidin-1-ylquinoxalin-6-yl)carbamoyl]-2-methoxyphenyl] acetate.
| Compound Name | [4-[(1,4-dimethyl-2,3-dioxo-7-piperidin-1-ylquinoxalin-6-yl)carbamoyl]-2-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 50792247 |
| Molecular Formula | C25H28N4O6 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | [4-[(1,4-dimethyl-2,3-dioxo-7-piperidin-1-ylquinoxalin-6-yl)carbamoyl]-2-methoxyphenyl] acetate |
| SMILES | COc1cc(C(=O)Nc2cc3c(cc2N2CCCCC2)n(C)c(=O)c(=O)n3C)ccc1OC(C)=O |
| InChI | InChI=1S/C25H28N4O6/c1-15(30)35-21-9-8-16(12-22(21)34-4)23(31)26-17-13-19-20(28(3)25(33)24(32)27(19)2)14-18(17)29-10-6-5-7-11-29/h8-9,12-14H,5-7,10-11H2,1-4H3,(H,26,31) |
| InChIKey | RHOVEAAVMLKCFE-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 111.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|