C21H21BrN4O3 — CID 50791980
2-bromo-N-(1,4-dimethyl-2,3-dioxo-7-pyrrolidin-1-ylquinoxalin-6-yl)benzamide (PubChem CID 50791980) has the molecular formula C21H21BrN4O3 and a molecular weight of 457.33 g/mol. Its IUPAC name is 2-bromo-N-(1,4-dimethyl-2,3-dioxo-7-pyrrolidin-1-ylquinoxalin-6-yl)benzamide.
| Compound Name | 2-bromo-N-(1,4-dimethyl-2,3-dioxo-7-pyrrolidin-1-ylquinoxalin-6-yl)benzamide |
|---|---|
| PubChem CID | 50791980 |
| Molecular Formula | C21H21BrN4O3 |
| Molecular Weight | 457.33 g/mol |
| Exact Mass | 456.08 |
| IUPAC Name | 2-bromo-N-(1,4-dimethyl-2,3-dioxo-7-pyrrolidin-1-ylquinoxalin-6-yl)benzamide |
| SMILES | Cn1c(=O)c(=O)n(C)c2cc(N3CCCC3)c(NC(=O)c3ccccc3Br)cc21 |
| InChI | InChI=1S/C21H21BrN4O3/c1-24-17-11-15(23-19(27)13-7-3-4-8-14(13)22)16(26-9-5-6-10-26)12-18(17)25(2)21(29)20(24)28/h3-4,7-8,11-12H,5-6,9-10H2,1-2H3,(H,23,27) |
| InChIKey | OHOUIROVYHGFKP-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 76.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.33 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|