C17H18INO3 — CID 1296960
N-(4-iodo-2,5-dimethylphenyl)-3,4-dimethoxybenzamide (PubChem CID 1296960) has the molecular formula C17H18INO3 and a molecular weight of 411.24 g/mol. Its IUPAC name is N-(4-iodo-2,5-dimethylphenyl)-3,4-dimethoxybenzamide.
| Compound Name | N-(4-iodo-2,5-dimethylphenyl)-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 1296960 |
| Molecular Formula | C17H18INO3 |
| Molecular Weight | 411.24 g/mol |
| Exact Mass | 411.03 |
| IUPAC Name | N-(4-iodo-2,5-dimethylphenyl)-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2cc(C)c(I)cc2C)cc1OC |
| InChI | InChI=1S/C17H18INO3/c1-10-8-14(11(2)7-13(10)18)19-17(20)12-5-6-15(21-3)16(9-12)22-4/h5-9H,1-4H3,(H,19,20) |
| InChIKey | NPHMEGUQCTVGNG-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.24 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|