C19H22N2O4 — CID 46489735
3-acetamido-N-(4,5-dimethoxy-2-methylphenyl)-4-methylbenzamide (PubChem CID 46489735) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is 3-acetamido-N-(4,5-dimethoxy-2-methylphenyl)-4-methylbenzamide.
| Compound Name | 3-acetamido-N-(4,5-dimethoxy-2-methylphenyl)-4-methylbenzamide |
|---|---|
| PubChem CID | 46489735 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 3-acetamido-N-(4,5-dimethoxy-2-methylphenyl)-4-methylbenzamide |
| SMILES | COc1cc(C)c(NC(=O)c2ccc(C)c(NC(C)=O)c2)cc1OC |
| InChI | InChI=1S/C19H22N2O4/c1-11-6-7-14(9-15(11)20-13(3)22)19(23)21-16-10-18(25-5)17(24-4)8-12(16)2/h6-10H,1-5H3,(H,20,22)(H,21,23) |
| InChIKey | NNNSEZYKFDUIJE-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |