C19H21NO3S2 — CID 40600054
N-(4,5-dimethoxy-2-methylphenyl)-4-(1,3-dithiolan-2-yl)benzamide (PubChem CID 40600054) has the molecular formula C19H21NO3S2 and a molecular weight of 375.52 g/mol. Its IUPAC name is N-(4,5-dimethoxy-2-methylphenyl)-4-(1,3-dithiolan-2-yl)benzamide.
| Compound Name | N-(4,5-dimethoxy-2-methylphenyl)-4-(1,3-dithiolan-2-yl)benzamide |
|---|---|
| PubChem CID | 40600054 |
| Molecular Formula | C19H21NO3S2 |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | N-(4,5-dimethoxy-2-methylphenyl)-4-(1,3-dithiolan-2-yl)benzamide |
| SMILES | COc1cc(C)c(NC(=O)c2ccc(C3SCCS3)cc2)cc1OC |
| InChI | InChI=1S/C19H21NO3S2/c1-12-10-16(22-2)17(23-3)11-15(12)20-18(21)13-4-6-14(7-5-13)19-24-8-9-25-19/h4-7,10-11,19H,8-9H2,1-3H3,(H,20,21) |
| InChIKey | FVGNLMXEUUKUJT-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |