C11H13NO2S2 — CID 27745104
4-(1,3-dithiolan-2-yl)-N-methoxybenzamide (PubChem CID 27745104) has the molecular formula C11H13NO2S2 and a molecular weight of 255.36 g/mol. Its IUPAC name is 4-(1,3-dithiolan-2-yl)-N-methoxybenzamide.
| Compound Name | 4-(1,3-dithiolan-2-yl)-N-methoxybenzamide |
|---|---|
| PubChem CID | 27745104 |
| Molecular Formula | C11H13NO2S2 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.04 |
| IUPAC Name | 4-(1,3-dithiolan-2-yl)-N-methoxybenzamide |
| SMILES | CONC(=O)c1ccc(C2SCCS2)cc1 |
| InChI | InChI=1S/C11H13NO2S2/c1-14-12-10(13)8-2-4-9(5-3-8)11-15-6-7-16-11/h2-5,11H,6-7H2,1H3,(H,12,13) |
| InChIKey | GEYJYDQYSBCOHS-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|