C18H19NOS2 — CID 26894465
N-(2,6-dimethylphenyl)-4-(1,3-dithiolan-2-yl)benzamide (PubChem CID 26894465) has the molecular formula C18H19NOS2 and a molecular weight of 329.49 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-4-(1,3-dithiolan-2-yl)benzamide.
| Compound Name | N-(2,6-dimethylphenyl)-4-(1,3-dithiolan-2-yl)benzamide |
|---|---|
| PubChem CID | 26894465 |
| Molecular Formula | C18H19NOS2 |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | N-(2,6-dimethylphenyl)-4-(1,3-dithiolan-2-yl)benzamide |
| SMILES | Cc1cccc(C)c1NC(=O)c1ccc(C2SCCS2)cc1 |
| InChI | InChI=1S/C18H19NOS2/c1-12-4-3-5-13(2)16(12)19-17(20)14-6-8-15(9-7-14)18-21-10-11-22-18/h3-9,18H,10-11H2,1-2H3,(H,19,20) |
| InChIKey | UJFKRDDQBSDWHT-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |