C17H16ClNOS2 — CID 8502374
N-(5-chloro-2-methylphenyl)-4-(1,3-dithiolan-2-yl)benzamide (PubChem CID 8502374) has the molecular formula C17H16ClNOS2 and a molecular weight of 349.91 g/mol. Its IUPAC name is N-(5-chloro-2-methylphenyl)-4-(1,3-dithiolan-2-yl)benzamide.
| Compound Name | N-(5-chloro-2-methylphenyl)-4-(1,3-dithiolan-2-yl)benzamide |
|---|---|
| PubChem CID | 8502374 |
| Molecular Formula | C17H16ClNOS2 |
| Molecular Weight | 349.91 g/mol |
| Exact Mass | 349.04 |
| IUPAC Name | N-(5-chloro-2-methylphenyl)-4-(1,3-dithiolan-2-yl)benzamide |
| SMILES | Cc1ccc(Cl)cc1NC(=O)c1ccc(C2SCCS2)cc1 |
| InChI | InChI=1S/C17H16ClNOS2/c1-11-2-7-14(18)10-15(11)19-16(20)12-3-5-13(6-4-12)17-21-8-9-22-17/h2-7,10,17H,8-9H2,1H3,(H,19,20) |
| InChIKey | ZWQRFDIHDXDYLO-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.91 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |