C17H16FNOS2 — CID 26881926
4-(1,3-dithiolan-2-yl)-N-(2-fluoro-5-methylphenyl)benzamide (PubChem CID 26881926) has the molecular formula C17H16FNOS2 and a molecular weight of 333.45 g/mol. Its IUPAC name is 4-(1,3-dithiolan-2-yl)-N-(2-fluoro-5-methylphenyl)benzamide.
| Compound Name | 4-(1,3-dithiolan-2-yl)-N-(2-fluoro-5-methylphenyl)benzamide |
|---|---|
| PubChem CID | 26881926 |
| Molecular Formula | C17H16FNOS2 |
| Molecular Weight | 333.45 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | 4-(1,3-dithiolan-2-yl)-N-(2-fluoro-5-methylphenyl)benzamide |
| SMILES | Cc1ccc(F)c(NC(=O)c2ccc(C3SCCS3)cc2)c1 |
| InChI | InChI=1S/C17H16FNOS2/c1-11-2-7-14(18)15(10-11)19-16(20)12-3-5-13(6-4-12)17-21-8-9-22-17/h2-7,10,17H,8-9H2,1H3,(H,19,20) |
| InChIKey | MYWWPRSILTUGGE-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.45 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |