C17H14F3NOS2 — CID 7962066
4-(1,3-dithiolan-2-yl)-N-[4-(trifluoromethyl)phenyl]benzamide (PubChem CID 7962066) has the molecular formula C17H14F3NOS2 and a molecular weight of 369.43 g/mol. Its IUPAC name is 4-(1,3-dithiolan-2-yl)-N-[4-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 4-(1,3-dithiolan-2-yl)-N-[4-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 7962066 |
| Molecular Formula | C17H14F3NOS2 |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | 4-(1,3-dithiolan-2-yl)-N-[4-(trifluoromethyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(C(F)(F)F)cc1)c1ccc(C2SCCS2)cc1 |
| InChI | InChI=1S/C17H14F3NOS2/c18-17(19,20)13-5-7-14(8-6-13)21-15(22)11-1-3-12(4-2-11)16-23-9-10-24-16/h1-8,16H,9-10H2,(H,21,22) |
| InChIKey | LTKSRIWDDWXPEF-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |