C19H18N2OS2 — CID 9261082
N-[4-(cyanomethyl)phenyl]-4-(1,3-dithian-2-yl)benzamide (PubChem CID 9261082) has the molecular formula C19H18N2OS2 and a molecular weight of 354.50 g/mol. Its IUPAC name is N-[4-(cyanomethyl)phenyl]-4-(1,3-dithian-2-yl)benzamide.
| Compound Name | N-[4-(cyanomethyl)phenyl]-4-(1,3-dithian-2-yl)benzamide |
|---|---|
| PubChem CID | 9261082 |
| Molecular Formula | C19H18N2OS2 |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | N-[4-(cyanomethyl)phenyl]-4-(1,3-dithian-2-yl)benzamide |
| SMILES | N#CCc1ccc(NC(=O)c2ccc(C3SCCCS3)cc2)cc1 |
| InChI | InChI=1S/C19H18N2OS2/c20-11-10-14-2-8-17(9-3-14)21-18(22)15-4-6-16(7-5-15)19-23-12-1-13-24-19/h2-9,19H,1,10,12-13H2,(H,21,22) |
| InChIKey | KUKMQTFLKJJCEL-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |