C22H24N2O2S2 — CID 24680771
N-[[4-(cyclopropanecarbonylamino)phenyl]methyl]-4-(1,3-dithian-2-yl)benzamide (PubChem CID 24680771) has the molecular formula C22H24N2O2S2 and a molecular weight of 412.58 g/mol. Its IUPAC name is N-[[4-(cyclopropanecarbonylamino)phenyl]methyl]-4-(1,3-dithian-2-yl)benzamide.
| Compound Name | N-[[4-(cyclopropanecarbonylamino)phenyl]methyl]-4-(1,3-dithian-2-yl)benzamide |
|---|---|
| PubChem CID | 24680771 |
| Molecular Formula | C22H24N2O2S2 |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | N-[[4-(cyclopropanecarbonylamino)phenyl]methyl]-4-(1,3-dithian-2-yl)benzamide |
| SMILES | O=C(NCc1ccc(NC(=O)C2CC2)cc1)c1ccc(C2SCCCS2)cc1 |
| InChI | InChI=1S/C22H24N2O2S2/c25-20(16-6-8-18(9-7-16)22-27-12-1-13-28-22)23-14-15-2-10-19(11-3-15)24-21(26)17-4-5-17/h2-3,6-11,17,22H,1,4-5,12-14H2,(H,23,25)(H,24,26) |
| InChIKey | PQVMTLSFBOMVJZ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |