C13H19ClN2OS2 — CID 119382886
N-(2-aminoethyl)-4-(1,3-dithian-2-yl)benzamide;hydrochloride (PubChem CID 119382886) has the molecular formula C13H19ClN2OS2 and a molecular weight of 318.90 g/mol. Its IUPAC name is N-(2-aminoethyl)-4-(1,3-dithian-2-yl)benzamide;hydrochloride.
| Compound Name | N-(2-aminoethyl)-4-(1,3-dithian-2-yl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119382886 |
| Molecular Formula | C13H19ClN2OS2 |
| Molecular Weight | 318.90 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | N-(2-aminoethyl)-4-(1,3-dithian-2-yl)benzamide;hydrochloride |
| SMILES | Cl.NCCNC(=O)c1ccc(C2SCCCS2)cc1 |
| InChI | InChI=1S/C13H18N2OS2.ClH/c14-6-7-15-12(16)10-2-4-11(5-3-10)13-17-8-1-9-18-13;/h2-5,13H,1,6-9,14H2,(H,15,16);1H |
| InChIKey | ZVHFEKAYDGGIJV-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.90 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |