C15H19NO3S2 — CID 119347784
3-[[4-(1,3-dithian-2-yl)benzoyl]amino]butanoic acid (PubChem CID 119347784) has the molecular formula C15H19NO3S2 and a molecular weight of 325.46 g/mol. Its IUPAC name is 3-[[4-(1,3-dithian-2-yl)benzoyl]amino]butanoic acid.
| Compound Name | 3-[[4-(1,3-dithian-2-yl)benzoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 119347784 |
| Molecular Formula | C15H19NO3S2 |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | 3-[[4-(1,3-dithian-2-yl)benzoyl]amino]butanoic acid |
| SMILES | CC(CC(=O)O)NC(=O)c1ccc(C2SCCCS2)cc1 |
| InChI | InChI=1S/C15H19NO3S2/c1-10(9-13(17)18)16-14(19)11-3-5-12(6-4-11)15-20-7-2-8-21-15/h3-6,10,15H,2,7-9H2,1H3,(H,16,19)(H,17,18) |
| InChIKey | FPLLXWVSQFUZRQ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |