C15H22N2OS2 — CID 119430624
4-(1,3-dithian-2-yl)-N-[3-(methylamino)propyl]benzamide (PubChem CID 119430624) has the molecular formula C15H22N2OS2 and a molecular weight of 310.49 g/mol. Its IUPAC name is 4-(1,3-dithian-2-yl)-N-[3-(methylamino)propyl]benzamide.
| Compound Name | 4-(1,3-dithian-2-yl)-N-[3-(methylamino)propyl]benzamide |
|---|---|
| PubChem CID | 119430624 |
| Molecular Formula | C15H22N2OS2 |
| Molecular Weight | 310.49 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 4-(1,3-dithian-2-yl)-N-[3-(methylamino)propyl]benzamide |
| SMILES | CNCCCNC(=O)c1ccc(C2SCCCS2)cc1 |
| InChI | InChI=1S/C15H22N2OS2/c1-16-8-2-9-17-14(18)12-4-6-13(7-5-12)15-19-10-3-11-20-15/h4-7,15-16H,2-3,8-11H2,1H3,(H,17,18) |
| InChIKey | DVVDIHBIWWWYMM-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.49 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|