C20H22FNOS3 — CID 8744638
4-(1,3-dithian-2-yl)-N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]benzamide (PubChem CID 8744638) has the molecular formula C20H22FNOS3 and a molecular weight of 407.60 g/mol. Its IUPAC name is 4-(1,3-dithian-2-yl)-N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]benzamide.
| Compound Name | 4-(1,3-dithian-2-yl)-N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]benzamide |
|---|---|
| PubChem CID | 8744638 |
| Molecular Formula | C20H22FNOS3 |
| Molecular Weight | 407.60 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | 4-(1,3-dithian-2-yl)-N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]benzamide |
| SMILES | O=C(NCCSCc1ccccc1F)c1ccc(C2SCCCS2)cc1 |
| InChI | InChI=1S/C20H22FNOS3/c21-18-5-2-1-4-17(18)14-24-13-10-22-19(23)15-6-8-16(9-7-15)20-25-11-3-12-26-20/h1-2,4-9,20H,3,10-14H2,(H,22,23) |
| InChIKey | ADUIHCOLSPGQKO-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.60 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|