C19H20ClNO2S2 — CID 8743375
N-[2-(4-chlorophenoxy)ethyl]-4-(1,3-dithian-2-yl)benzamide (PubChem CID 8743375) has the molecular formula C19H20ClNO2S2 and a molecular weight of 393.96 g/mol. Its IUPAC name is N-[2-(4-chlorophenoxy)ethyl]-4-(1,3-dithian-2-yl)benzamide.
| Compound Name | N-[2-(4-chlorophenoxy)ethyl]-4-(1,3-dithian-2-yl)benzamide |
|---|---|
| PubChem CID | 8743375 |
| Molecular Formula | C19H20ClNO2S2 |
| Molecular Weight | 393.96 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | N-[2-(4-chlorophenoxy)ethyl]-4-(1,3-dithian-2-yl)benzamide |
| SMILES | O=C(NCCOc1ccc(Cl)cc1)c1ccc(C2SCCCS2)cc1 |
| InChI | InChI=1S/C19H20ClNO2S2/c20-16-6-8-17(9-7-16)23-11-10-21-18(22)14-2-4-15(5-3-14)19-24-12-1-13-25-19/h2-9,19H,1,10-13H2,(H,21,22) |
| InChIKey | XBDSZKGPCGLGOB-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.96 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|