C17H17ClN2O2S2 — CID 55436153
N-(5-chloro-2-pyridinyl)-2-[4-(1,3-dithian-2-yl)phenoxy]acetamide (PubChem CID 55436153) has the molecular formula C17H17ClN2O2S2 and a molecular weight of 380.92 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-2-[4-(1,3-dithian-2-yl)phenoxy]acetamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-2-[4-(1,3-dithian-2-yl)phenoxy]acetamide |
|---|---|
| PubChem CID | 55436153 |
| Molecular Formula | C17H17ClN2O2S2 |
| Molecular Weight | 380.92 g/mol |
| Exact Mass | 380.04 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-2-[4-(1,3-dithian-2-yl)phenoxy]acetamide |
| SMILES | O=C(COc1ccc(C2SCCCS2)cc1)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C17H17ClN2O2S2/c18-13-4-7-15(19-10-13)20-16(21)11-22-14-5-2-12(3-6-14)17-23-8-1-9-24-17/h2-7,10,17H,1,8-9,11H2,(H,19,20,21) |
| InChIKey | ZWSNCILRGFTTQN-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.92 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |