C18H16F3NO2S2 — CID 55382041
2-[4-(1,3-dithian-2-yl)phenoxy]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 55382041) has the molecular formula C18H16F3NO2S2 and a molecular weight of 399.46 g/mol. Its IUPAC name is 2-[4-(1,3-dithian-2-yl)phenoxy]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[4-(1,3-dithian-2-yl)phenoxy]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 55382041 |
| Molecular Formula | C18H16F3NO2S2 |
| Molecular Weight | 399.46 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | 2-[4-(1,3-dithian-2-yl)phenoxy]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | O=C(COc1ccc(C2SCCCS2)cc1)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C18H16F3NO2S2/c19-13-6-7-14(17(21)16(13)20)22-15(23)10-24-12-4-2-11(3-5-12)18-25-8-1-9-26-18/h2-7,18H,1,8-10H2,(H,22,23) |
| InChIKey | GMYKZOMEKFNMLP-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.46 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|