C19H19F2NO3S2 — CID 7603238
N-[4-(difluoromethoxy)phenyl]-2-[4-(1,3-dithian-2-yl)phenoxy]acetamide (PubChem CID 7603238) has the molecular formula C19H19F2NO3S2 and a molecular weight of 411.50 g/mol. Its IUPAC name is N-[4-(difluoromethoxy)phenyl]-2-[4-(1,3-dithian-2-yl)phenoxy]acetamide.
| Compound Name | N-[4-(difluoromethoxy)phenyl]-2-[4-(1,3-dithian-2-yl)phenoxy]acetamide |
|---|---|
| PubChem CID | 7603238 |
| Molecular Formula | C19H19F2NO3S2 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | N-[4-(difluoromethoxy)phenyl]-2-[4-(1,3-dithian-2-yl)phenoxy]acetamide |
| SMILES | O=C(COc1ccc(C2SCCCS2)cc1)Nc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C19H19F2NO3S2/c20-19(21)25-16-8-4-14(5-9-16)22-17(23)12-24-15-6-2-13(3-7-15)18-26-10-1-11-27-18/h2-9,18-19H,1,10-12H2,(H,22,23) |
| InChIKey | XIJPYIYOZLTFTG-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |