C21H23NO4S2 — CID 55385627
[2-(4-methylanilino)-2-oxoethyl] 2-[4-(1,3-dithian-2-yl)phenoxy]acetate (PubChem CID 55385627) has the molecular formula C21H23NO4S2 and a molecular weight of 417.55 g/mol. Its IUPAC name is [2-(4-methylanilino)-2-oxoethyl] 2-[4-(1,3-dithian-2-yl)phenoxy]acetate.
| Compound Name | [2-(4-methylanilino)-2-oxoethyl] 2-[4-(1,3-dithian-2-yl)phenoxy]acetate |
|---|---|
| PubChem CID | 55385627 |
| Molecular Formula | C21H23NO4S2 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | [2-(4-methylanilino)-2-oxoethyl] 2-[4-(1,3-dithian-2-yl)phenoxy]acetate |
| SMILES | Cc1ccc(NC(=O)COC(=O)COc2ccc(C3SCCCS3)cc2)cc1 |
| InChI | InChI=1S/C21H23NO4S2/c1-15-3-7-17(8-4-15)22-19(23)13-26-20(24)14-25-18-9-5-16(6-10-18)21-27-11-2-12-28-21/h3-10,21H,2,11-14H2,1H3,(H,22,23) |
| InChIKey | MNVIGAYUUBYSGU-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |