About [2-(4-methylanilino)-2-oxoethyl] 2-(4-iodophenoxy)acetate
[2-(4-methylanilino)-2-oxoethyl] 2-(4-iodophenoxy)acetate (PubChem CID 55327028) has the molecular formula C17H16INO4
and a molecular weight of 425.22 g/mol. Its IUPAC name is [2-(4-methylanilino)-2-oxoethyl] 2-(4-iodophenoxy)acetate.
Molecular Properties
| Compound Name | [2-(4-methylanilino)-2-oxoethyl] 2-(4-iodophenoxy)acetate |
| PubChem CID | 55327028 |
| Molecular Formula | C17H16INO4 |
| Molecular Weight | 425.22 g/mol |
| Exact Mass | 425.01 |
| IUPAC Name | [2-(4-methylanilino)-2-oxoethyl] 2-(4-iodophenoxy)acetate |
| SMILES | Cc1ccc(NC(=O)COC(=O)COc2ccc(I)cc2)cc1 |
| InChI | InChI=1S/C17H16INO4/c1-12-2-6-14(7-3-12)19-16(20)10-23-17(21)11-22-15-8-4-13(18)5-9-15/h2-9H,10-11H2,1H3,(H,19,20) |
| InChIKey | AZJIZESZQOCZLE-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.22 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [2-(4-methylanilino)-2-oxoethyl] 2-(4-iodophenoxy)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-methylanilino)-2-oxoethyl] 2-(4-iodophenoxy)acetate?
The IUPAC name of [2-(4-methylanilino)-2-oxoethyl] 2-(4-iodophenoxy)acetate (CID 55327028) is [2-(4-methylanilino)-2-oxoethyl] 2-(4-iodophenoxy)acetate.
What is the SMILES notation for [2-(4-methylanilino)-2-oxoethyl] 2-(4-iodophenoxy)acetate?
The canonical SMILES for [2-(4-methylanilino)-2-oxoethyl] 2-(4-iodophenoxy)acetate is Cc1ccc(NC(=O)COC(=O)COc2ccc(I)cc2)cc1.
What is the InChIKey of [2-(4-methylanilino)-2-oxoethyl] 2-(4-iodophenoxy)acetate?
The InChIKey is AZJIZESZQOCZLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16INO4/c1-12-2-6-14(7-3-12)19-16(20)10-23-17(21)11-22-15-8-4-13(18)5-9-15/h2-9H,10-11H2,1H3,(H,19,20).
What are the key properties of [2-(4-methylanilino)-2-oxoethyl] 2-(4-iodophenoxy)acetate?
[2-(4-methylanilino)-2-oxoethyl] 2-(4-iodophenoxy)acetate has a molecular weight of 425.22 g/mol, XLogP of 3.16, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-methylanilino)-2-oxoethyl] 2-(4-iodophenoxy)acetate is sourced from PubChem (CID 55327028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).