C16H14INO5 — CID 1288987
2-[4-[[2-(4-iodophenoxy)acetyl]amino]phenoxy]acetic acid (PubChem CID 1288987) has the molecular formula C16H14INO5 and a molecular weight of 427.19 g/mol. Its IUPAC name is 2-[4-[[2-(4-iodophenoxy)acetyl]amino]phenoxy]acetic acid.
| Compound Name | 2-[4-[[2-(4-iodophenoxy)acetyl]amino]phenoxy]acetic acid |
|---|---|
| PubChem CID | 1288987 |
| Molecular Formula | C16H14INO5 |
| Molecular Weight | 427.19 g/mol |
| Exact Mass | 426.99 |
| IUPAC Name | 2-[4-[[2-(4-iodophenoxy)acetyl]amino]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(NC(=O)COc2ccc(I)cc2)cc1 |
| InChI | InChI=1S/C16H14INO5/c17-11-1-5-13(6-2-11)22-9-15(19)18-12-3-7-14(8-4-12)23-10-16(20)21/h1-8H,9-10H2,(H,18,19)(H,20,21) |
| InChIKey | PAHZHCLLTMRCNP-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.19 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|