C16H17IN2O4S — CID 30128438
N-(4-iodophenyl)-2-[4-[methyl(methylsulfonyl)amino]phenoxy]acetamide (PubChem CID 30128438) has the molecular formula C16H17IN2O4S and a molecular weight of 460.29 g/mol. Its IUPAC name is N-(4-iodophenyl)-2-[4-[methyl(methylsulfonyl)amino]phenoxy]acetamide.
| Compound Name | N-(4-iodophenyl)-2-[4-[methyl(methylsulfonyl)amino]phenoxy]acetamide |
|---|---|
| PubChem CID | 30128438 |
| Molecular Formula | C16H17IN2O4S |
| Molecular Weight | 460.29 g/mol |
| Exact Mass | 460.00 |
| IUPAC Name | N-(4-iodophenyl)-2-[4-[methyl(methylsulfonyl)amino]phenoxy]acetamide |
| SMILES | CN(c1ccc(OCC(=O)Nc2ccc(I)cc2)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C16H17IN2O4S/c1-19(24(2,21)22)14-7-9-15(10-8-14)23-11-16(20)18-13-5-3-12(17)4-6-13/h3-10H,11H2,1-2H3,(H,18,20) |
| InChIKey | BFVQCJSZUXARRA-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.29 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|