C17H16INO5 — CID 17342102
2-[4-[[2-(4-iodophenoxy)acetyl]amino]-3-methylphenoxy]acetic acid (PubChem CID 17342102) has the molecular formula C17H16INO5 and a molecular weight of 441.22 g/mol. Its IUPAC name is 2-[4-[[2-(4-iodophenoxy)acetyl]amino]-3-methylphenoxy]acetic acid.
| Compound Name | 2-[4-[[2-(4-iodophenoxy)acetyl]amino]-3-methylphenoxy]acetic acid |
|---|---|
| PubChem CID | 17342102 |
| Molecular Formula | C17H16INO5 |
| Molecular Weight | 441.22 g/mol |
| Exact Mass | 441.01 |
| IUPAC Name | 2-[4-[[2-(4-iodophenoxy)acetyl]amino]-3-methylphenoxy]acetic acid |
| SMILES | Cc1cc(OCC(=O)O)ccc1NC(=O)COc1ccc(I)cc1 |
| InChI | InChI=1S/C17H16INO5/c1-11-8-14(24-10-17(21)22)6-7-15(11)19-16(20)9-23-13-4-2-12(18)3-5-13/h2-8H,9-10H2,1H3,(H,19,20)(H,21,22) |
| InChIKey | CUDVSAMMSNOCBX-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.22 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|