C19H20ClNO2S2 — CID 7602844
N-(2-chloro-4-methylphenyl)-2-[4-(1,3-dithian-2-yl)phenoxy]acetamide (PubChem CID 7602844) has the molecular formula C19H20ClNO2S2 and a molecular weight of 393.96 g/mol. Its IUPAC name is N-(2-chloro-4-methylphenyl)-2-[4-(1,3-dithian-2-yl)phenoxy]acetamide.
| Compound Name | N-(2-chloro-4-methylphenyl)-2-[4-(1,3-dithian-2-yl)phenoxy]acetamide |
|---|---|
| PubChem CID | 7602844 |
| Molecular Formula | C19H20ClNO2S2 |
| Molecular Weight | 393.96 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | N-(2-chloro-4-methylphenyl)-2-[4-(1,3-dithian-2-yl)phenoxy]acetamide |
| SMILES | Cc1ccc(NC(=O)COc2ccc(C3SCCCS3)cc2)c(Cl)c1 |
| InChI | InChI=1S/C19H20ClNO2S2/c1-13-3-8-17(16(20)11-13)21-18(22)12-23-15-6-4-14(5-7-15)19-24-9-2-10-25-19/h3-8,11,19H,2,9-10,12H2,1H3,(H,21,22) |
| InChIKey | REZXSRLOLVXFTP-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.96 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |