C19H20FNO2S2 — CID 60594803
2-[4-(1,3-dithian-2-yl)phenoxy]-N-(3-fluoro-4-methylphenyl)acetamide (PubChem CID 60594803) has the molecular formula C19H20FNO2S2 and a molecular weight of 377.51 g/mol. Its IUPAC name is 2-[4-(1,3-dithian-2-yl)phenoxy]-N-(3-fluoro-4-methylphenyl)acetamide.
| Compound Name | 2-[4-(1,3-dithian-2-yl)phenoxy]-N-(3-fluoro-4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 60594803 |
| Molecular Formula | C19H20FNO2S2 |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | 2-[4-(1,3-dithian-2-yl)phenoxy]-N-(3-fluoro-4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)COc2ccc(C3SCCCS3)cc2)cc1F |
| InChI | InChI=1S/C19H20FNO2S2/c1-13-3-6-15(11-17(13)20)21-18(22)12-23-16-7-4-14(5-8-16)19-24-9-2-10-25-19/h3-8,11,19H,2,9-10,12H2,1H3,(H,21,22) |
| InChIKey | MZBOJDVOZUFUSS-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |