C21H25NO2S2 — CID 55382007
2-[4-(1,3-dithian-2-yl)phenoxy]-N-(2-ethyl-6-methylphenyl)acetamide (PubChem CID 55382007) has the molecular formula C21H25NO2S2 and a molecular weight of 387.57 g/mol. Its IUPAC name is 2-[4-(1,3-dithian-2-yl)phenoxy]-N-(2-ethyl-6-methylphenyl)acetamide.
| Compound Name | 2-[4-(1,3-dithian-2-yl)phenoxy]-N-(2-ethyl-6-methylphenyl)acetamide |
|---|---|
| PubChem CID | 55382007 |
| Molecular Formula | C21H25NO2S2 |
| Molecular Weight | 387.57 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 2-[4-(1,3-dithian-2-yl)phenoxy]-N-(2-ethyl-6-methylphenyl)acetamide |
| SMILES | CCc1cccc(C)c1NC(=O)COc1ccc(C2SCCCS2)cc1 |
| InChI | InChI=1S/C21H25NO2S2/c1-3-16-7-4-6-15(2)20(16)22-19(23)14-24-18-10-8-17(9-11-18)21-25-12-5-13-26-21/h4,6-11,21H,3,5,12-14H2,1-2H3,(H,22,23) |
| InChIKey | VYQGUSKNZZCGEA-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.57 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |