C22H25NO3S2 — CID 7744451
[2-(2,6-diethylanilino)-2-oxoethyl] 4-(1,3-dithiolan-2-yl)benzoate (PubChem CID 7744451) has the molecular formula C22H25NO3S2 and a molecular weight of 415.58 g/mol. Its IUPAC name is [2-(2,6-diethylanilino)-2-oxoethyl] 4-(1,3-dithiolan-2-yl)benzoate.
| Compound Name | [2-(2,6-diethylanilino)-2-oxoethyl] 4-(1,3-dithiolan-2-yl)benzoate |
|---|---|
| PubChem CID | 7744451 |
| Molecular Formula | C22H25NO3S2 |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | [2-(2,6-diethylanilino)-2-oxoethyl] 4-(1,3-dithiolan-2-yl)benzoate |
| SMILES | CCc1cccc(CC)c1NC(=O)COC(=O)c1ccc(C2SCCS2)cc1 |
| InChI | InChI=1S/C22H25NO3S2/c1-3-15-6-5-7-16(4-2)20(15)23-19(24)14-26-21(25)17-8-10-18(11-9-17)22-27-12-13-28-22/h5-11,22H,3-4,12-14H2,1-2H3,(H,23,24) |
| InChIKey | IXQFATNDQWJIEN-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |