C17H23NO3S2 — CID 7744279
[2-oxo-2-[[(2S)-pentan-2-yl]amino]ethyl] 4-(1,3-dithiolan-2-yl)benzoate (PubChem CID 7744279) has the molecular formula C17H23NO3S2 and a molecular weight of 353.51 g/mol. Its IUPAC name is [2-oxo-2-[[(2S)-pentan-2-yl]amino]ethyl] 4-(1,3-dithiolan-2-yl)benzoate.
| Compound Name | [2-oxo-2-[[(2S)-pentan-2-yl]amino]ethyl] 4-(1,3-dithiolan-2-yl)benzoate |
|---|---|
| PubChem CID | 7744279 |
| Molecular Formula | C17H23NO3S2 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | [2-oxo-2-[[(2S)-pentan-2-yl]amino]ethyl] 4-(1,3-dithiolan-2-yl)benzoate |
| SMILES | CCC[C@H](C)NC(=O)COC(=O)c1ccc(C2SCCS2)cc1 |
| InChI | InChI=1S/C17H23NO3S2/c1-3-4-12(2)18-15(19)11-21-16(20)13-5-7-14(8-6-13)17-22-9-10-23-17/h5-8,12,17H,3-4,9-11H2,1-2H3,(H,18,19)/t12-/m0/s1 |
| InChIKey | HMXZIULFTRXGKA-LBPRGKRZSA-N |
| XLogP | 3.63 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |