C17H22N2O4S2 — CID 7744216
[2-(tert-butylcarbamoylamino)-2-oxoethyl] 4-(1,3-dithiolan-2-yl)benzoate (PubChem CID 7744216) has the molecular formula C17H22N2O4S2 and a molecular weight of 382.51 g/mol. Its IUPAC name is [2-(tert-butylcarbamoylamino)-2-oxoethyl] 4-(1,3-dithiolan-2-yl)benzoate.
| Compound Name | [2-(tert-butylcarbamoylamino)-2-oxoethyl] 4-(1,3-dithiolan-2-yl)benzoate |
|---|---|
| PubChem CID | 7744216 |
| Molecular Formula | C17H22N2O4S2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | [2-(tert-butylcarbamoylamino)-2-oxoethyl] 4-(1,3-dithiolan-2-yl)benzoate |
| SMILES | CC(C)(C)NC(=O)NC(=O)COC(=O)c1ccc(C2SCCS2)cc1 |
| InChI | InChI=1S/C17H22N2O4S2/c1-17(2,3)19-16(22)18-13(20)10-23-14(21)11-4-6-12(7-5-11)15-24-8-9-25-15/h4-7,15H,8-10H2,1-3H3,(H2,18,19,20,22) |
| InChIKey | BPKGMTXTNGHSPI-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |