C18H26N2O3S2 — CID 51578802
(2R)-2-[[2-[4-(1,3-dithian-2-yl)phenoxy]acetyl]amino]-N-propylpropanamide (PubChem CID 51578802) has the molecular formula C18H26N2O3S2 and a molecular weight of 382.55 g/mol. Its IUPAC name is (2R)-2-[[2-[4-(1,3-dithian-2-yl)phenoxy]acetyl]amino]-N-propylpropanamide.
| Compound Name | (2R)-2-[[2-[4-(1,3-dithian-2-yl)phenoxy]acetyl]amino]-N-propylpropanamide |
|---|---|
| PubChem CID | 51578802 |
| Molecular Formula | C18H26N2O3S2 |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | (2R)-2-[[2-[4-(1,3-dithian-2-yl)phenoxy]acetyl]amino]-N-propylpropanamide |
| SMILES | CCCNC(=O)[C@@H](C)NC(=O)COc1ccc(C2SCCCS2)cc1 |
| InChI | InChI=1S/C18H26N2O3S2/c1-3-9-19-17(22)13(2)20-16(21)12-23-15-7-5-14(6-8-15)18-24-10-4-11-25-18/h5-8,13,18H,3-4,9-12H2,1-2H3,(H,19,22)(H,20,21)/t13-/m1/s1 |
| InChIKey | YNDFDDMQAPLRHR-CYBMUJFWSA-N |
| XLogP | 2.96 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |