C20H23NO2S2 — CID 17478347
2-[4-(1,3-dithian-2-yl)phenoxy]-N-(2-phenylethyl)acetamide (PubChem CID 17478347) has the molecular formula C20H23NO2S2 and a molecular weight of 373.54 g/mol. Its IUPAC name is 2-[4-(1,3-dithian-2-yl)phenoxy]-N-(2-phenylethyl)acetamide.
| Compound Name | 2-[4-(1,3-dithian-2-yl)phenoxy]-N-(2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 17478347 |
| Molecular Formula | C20H23NO2S2 |
| Molecular Weight | 373.54 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 2-[4-(1,3-dithian-2-yl)phenoxy]-N-(2-phenylethyl)acetamide |
| SMILES | O=C(COc1ccc(C2SCCCS2)cc1)NCCc1ccccc1 |
| InChI | InChI=1S/C20H23NO2S2/c22-19(21-12-11-16-5-2-1-3-6-16)15-23-18-9-7-17(8-10-18)20-24-13-4-14-25-20/h1-3,5-10,20H,4,11-15H2,(H,21,22) |
| InChIKey | QGUPSXHGILLHOM-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.54 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |